| Compound Name | : | ADENOSINE | |
| Compound ID | : | ADN | |
| Molecular Formula | : | C10 H13 N5 O4 | |
| Molecular weight | : | 267.24 g/mol | |
| Smile | : | c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N | |
| Number of Proteins (only with ADN) | : |
195 | |
| Select a Viewer: Jmol JSmol | |||
| Compound Name | : | ADENOSINE | |
| Compound ID | : | ADN | |
| Molecular Formula | : | C10 H13 N5 O4 | |
| Molecular weight | : | 267.24 g/mol | |
| Smile | : | c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N | |
| Number of Proteins (only with ADN) | : |
195 | |
| Select a Viewer: Jmol JSmol | |||
