| Compound Name | : | GUANOSINE | |
| Compound ID | : | GMP | |
| Molecular Formula | : | C10 H13 N5 O5 | |
| Molecular weight | : | 283.24 g/mol | |
| Smile | : | c1nc2c(n1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=C(NC2=O)N | |
| Number of Proteins (only with GMP) | : |
48 | |
| Select a Viewer: Jmol JSmol | |||
| Compound Name | : | GUANOSINE | |
| Compound ID | : | GMP | |
| Molecular Formula | : | C10 H13 N5 O5 | |
| Molecular weight | : | 283.24 g/mol | |
| Smile | : | c1nc2c(n1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=C(NC2=O)N | |
| Number of Proteins (only with GMP) | : |
48 | |
| Select a Viewer: Jmol JSmol | |||
