| Compound Name | : | GUANINE | |
| Compound ID | : | GUN | |
| Molecular Formula | : | C5 H5 N5 O | |
| Molecular weight | : | 151.13 g/mol | |
| Smile | : | c1[nH]c2c(n1)C(=O)NC(=N2)N | |
| Number of Proteins (only with GUN) | : |
53 | |
| Select a Viewer: Jmol JSmol | |||
| Compound Name | : | GUANINE | |
| Compound ID | : | GUN | |
| Molecular Formula | : | C5 H5 N5 O | |
| Molecular weight | : | 151.13 g/mol | |
| Smile | : | c1[nH]c2c(n1)C(=O)NC(=N2)N | |
| Number of Proteins (only with GUN) | : |
53 | |
| Select a Viewer: Jmol JSmol | |||
