| Compound Name | : | THYMIDINE | |
| Compound ID | : | THM | |
| Molecular Formula | : | C10 H14 N2 O5 | |
| Molecular weight | : | 242.23 g/mol | |
| Smile | : | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O | |
| Number of Proteins (only with THM) | : |
56 | |
| Select a Viewer: Jmol JSmol | |||
| Compound Name | : | THYMIDINE | |
| Compound ID | : | THM | |
| Molecular Formula | : | C10 H14 N2 O5 | |
| Molecular weight | : | 242.23 g/mol | |
| Smile | : | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O | |
| Number of Proteins (only with THM) | : |
56 | |
| Select a Viewer: Jmol JSmol | |||
