| Compound Name | : | URIDINE | |
| Compound ID | : | URI | |
| Molecular Formula | : | C9 H12 N2 O6 | |
| Molecular weight | : | 244.20 g/mol | |
| Smile | : | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O | |
| Number of Proteins (only with URI) | : |
33 | |
| Select a Viewer: Jmol JSmol | |||
| Compound Name | : | URIDINE | |
| Compound ID | : | URI | |
| Molecular Formula | : | C9 H12 N2 O6 | |
| Molecular weight | : | 244.20 g/mol | |
| Smile | : | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O | |
| Number of Proteins (only with URI) | : |
33 | |
| Select a Viewer: Jmol JSmol | |||
